C20H25N3O5 — CID 9080904
N'-[2-(2,3-dimethylanilino)acetyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 9080904) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylanilino)acetyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[2-(2,3-dimethylanilino)acetyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 9080904 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N'-[2-(2,3-dimethylanilino)acetyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CNc2cccc(C)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N3O5/c1-12-7-6-8-15(13(12)2)21-11-18(24)22-23-20(25)14-9-16(26-3)19(28-5)17(10-14)27-4/h6-10,21H,11H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | QAKPOVOEYQJLTE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|