C29H25N3O2S — CID 4937556
N-benzyl-N-methyl-2-(3-naphthalen-1-ylprop-2-enoylcarbamothioylamino)benzamide (PubChem CID 4937556) has the molecular formula C29H25N3O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-(3-naphthalen-1-ylprop-2-enoylcarbamothioylamino)benzamide.
| Compound Name | N-benzyl-N-methyl-2-(3-naphthalen-1-ylprop-2-enoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 4937556 |
| Molecular Formula | C29H25N3O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-benzyl-N-methyl-2-(3-naphthalen-1-ylprop-2-enoylcarbamothioylamino)benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccccc1NC(=S)NC(=O)C=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C29H25N3O2S/c1-32(20-21-10-3-2-4-11-21)28(34)25-16-7-8-17-26(25)30-29(35)31-27(33)19-18-23-14-9-13-22-12-5-6-15-24(22)23/h2-19H,20H2,1H3,(H2,30,31,33,35) |
| InChIKey | YWLCWUVGYLVRHW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|