C20H15FN2OS — CID 4927958
N-[(2-fluorophenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 4927958) has the molecular formula C20H15FN2OS and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(2-fluorophenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | N-[(2-fluorophenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 4927958 |
| Molecular Formula | C20H15FN2OS |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-[(2-fluorophenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccc2ccccc12)NC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C20H15FN2OS/c21-17-10-3-4-11-18(17)22-20(25)23-19(24)13-12-15-8-5-7-14-6-1-2-9-16(14)15/h1-13H,(H2,22,23,24,25) |
| InChIKey | KMLQXQKEUSUUAY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|