C23H23N3O5S — CID 108805887
(E)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108805887) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is (E)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108805887 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (E)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=O)/C=C/c3coc4ccccc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C23H23N3O5S/c1-25-12-14-26(15-13-25)32(29,30)19-9-7-18(8-10-19)24-22(27)11-6-17-16-31-21-5-3-2-4-20(21)23(17)28/h2-11,16H,12-15H2,1H3,(H,24,27)/b11-6+ |
| InChIKey | HLIMPKYVYGZPJY-IZZDOVSWSA-N |
| XLogP | 2.38 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|