C22H19ClN2O6S — CID 108794091
(E)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108794091) has the molecular formula C22H19ClN2O6S and a molecular weight of 474.92 g/mol. Its IUPAC name is (E)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108794091 |
| Molecular Formula | C22H19ClN2O6S |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (E)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(4-oxochromen-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1coc2ccccc2c1=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C22H19ClN2O6S/c23-18-7-6-16(32(28,29)25-9-11-30-12-10-25)13-19(18)24-21(26)8-5-15-14-31-20-4-2-1-3-17(20)22(15)27/h1-8,13-14H,9-12H2,(H,24,26)/b8-5+ |
| InChIKey | ISOJMNHSYAONRK-VMPITWQZSA-N |
| XLogP | 3.12 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|