C25H26N2O5S — CID 46385896
N-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 46385896) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 46385896 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)c2)cc1OC |
| InChI | InChI=1S/C25H26N2O5S/c1-31-23-13-10-21(17-24(23)32-2)26-25(28)20-7-5-6-19(16-20)18-8-11-22(12-9-18)33(29,30)27-14-3-4-15-27/h5-13,16-17H,3-4,14-15H2,1-2H3,(H,26,28) |
| InChIKey | PNEKXXFPFOSWRN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |