C20H23N3O5S — CID 43049761
methyl 6-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]carbamoyl]pyridine-3-carboxylate (PubChem CID 43049761) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is methyl 6-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]carbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 43049761 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | methyl 6-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]carbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCC(C)C3)cc2)nc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-14-4-3-11-23(13-14)29(26,27)17-8-6-16(7-9-17)22-19(24)18-10-5-15(12-21-18)20(25)28-2/h5-10,12,14H,3-4,11,13H2,1-2H3,(H,22,24) |
| InChIKey | KOXIPMBCRLBITH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |