C24H23N5O8S — CID 17319594
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]-3,5-dinitrobenzamide (PubChem CID 17319594) has the molecular formula C24H23N5O8S and a molecular weight of 541.54 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 17319594 |
| Molecular Formula | C24H23N5O8S |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]-3,5-dinitrobenzamide |
| SMILES | COc1ccccc1N1CCN(S(=O)(=O)c2ccc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C24H23N5O8S/c1-37-23-5-3-2-4-22(23)26-10-12-27(13-11-26)38(35,36)21-8-6-18(7-9-21)25-24(30)17-14-19(28(31)32)16-20(15-17)29(33)34/h2-9,14-16H,10-13H2,1H3,(H,25,30) |
| InChIKey | HJYKGBGPRZWEJJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|