C17H19N3O4S2 — CID 55905052
N-(3-cyano-5-ethylthiophen-2-yl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55905052) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(3-cyano-5-ethylthiophen-2-yl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(3-cyano-5-ethylthiophen-2-yl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55905052 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(3-cyano-5-ethylthiophen-2-yl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | CCc1cc(C#N)c(NC(=O)c2ccc(S(=O)(=O)N3CCCCC3)o2)s1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-2-13-10-12(11-18)17(25-13)19-16(21)14-6-7-15(24-14)26(22,23)20-8-4-3-5-9-20/h6-7,10H,2-5,8-9H2,1H3,(H,19,21) |
| InChIKey | GPDRUQGZJINVJY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |