C21H25N3O3S2 — CID 55905047
N-(3-cyano-5-ethylthiophen-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide (PubChem CID 55905047) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-(3-cyano-5-ethylthiophen-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide.
| Compound Name | N-(3-cyano-5-ethylthiophen-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55905047 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-(3-cyano-5-ethylthiophen-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]benzamide |
| SMILES | CCc1cc(C#N)c(NC(=O)c2ccc(S(=O)(=O)N(C)C3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C21H25N3O3S2/c1-3-18-13-16(14-22)21(28-18)23-20(25)15-9-11-19(12-10-15)29(26,27)24(2)17-7-5-4-6-8-17/h9-13,17H,3-8H2,1-2H3,(H,23,25) |
| InChIKey | CTKLQFBUOKGLID-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |