C21H30N2O3S — CID 46560441
N-[1-(1-adamantyl)ethyl]-3-(ethylsulfamoyl)benzamide (PubChem CID 46560441) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3-(ethylsulfamoyl)benzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3-(ethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46560441 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3-(ethylsulfamoyl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H30N2O3S/c1-3-22-27(25,26)19-6-4-5-18(10-19)20(24)23-14(2)21-11-15-7-16(12-21)9-17(8-15)13-21/h4-6,10,14-17,22H,3,7-9,11-13H2,1-2H3,(H,23,24) |
| InChIKey | HJGBQXXXVKKFQM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |