C24H34N2O3S — CID 7929606
N-[(1R)-1-(1-adamantyl)ethyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 7929606) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 7929606 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | C[C@@H](NC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H34N2O3S/c1-17(24-14-18-10-19(15-24)12-20(11-18)16-24)25-23(27)21-6-5-7-22(13-21)30(28,29)26-8-3-2-4-9-26/h5-7,13,17-20H,2-4,8-12,14-16H2,1H3,(H,25,27)/t17-,18?,19?,20?,24?/m1/s1 |
| InChIKey | ICLFUCLZTOBELH-OQOKOFKUSA-N |
| XLogP | 4.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |