C12H19N3O4 — CID 106279306
2-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]carbamoylamino]pent-4-ynoic acid (PubChem CID 106279306) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]carbamoylamino]pent-4-ynoic acid.
| Compound Name | 2-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]carbamoylamino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 106279306 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]carbamoylamino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)NCC(C)(C)C(=O)NC)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-5-6-8(9(16)17)15-11(19)14-7-12(2,3)10(18)13-4/h1,8H,6-7H2,2-4H3,(H,13,18)(H,16,17)(H2,14,15,19) |
| InChIKey | MCBKRRNDQTXTMU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|