C35H54N8O7S2 — CID 134131074
(2S)-6-acetamido-2-[[(2S)-6-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]-2-[[(2S)-2,6-diacetamidohexanoyl]amino]hexanoyl]amino]hexanamide (PubChem CID 134131074) has the molecular formula C35H54N8O7S2 and a molecular weight of 763.00 g/mol. Its IUPAC name is (2S)-6-acetamido-2-[[(2S)-6-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]-2-[[(2S)-2,6-diacetamidohexanoyl]amino]hexanoyl]amino]hexanamide.
| Compound Name | (2S)-6-acetamido-2-[[(2S)-6-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]-2-[[(2S)-2,6-diacetamidohexanoyl]amino]hexanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 134131074 |
| Molecular Formula | C35H54N8O7S2 |
| Molecular Weight | 763.00 g/mol |
| Exact Mass | 762.36 |
| IUPAC Name | (2S)-6-acetamido-2-[[(2S)-6-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]-2-[[(2S)-2,6-diacetamidohexanoyl]amino]hexanoyl]amino]hexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(=O)[C@H](CCCCNC(=O)CCCSc1nc2ccccc2s1)NC(=O)[C@H](CCCCNC(C)=O)NC(C)=O)C(N)=O |
| InChI | InChI=1S/C35H54N8O7S2/c1-23(44)37-19-9-6-14-27(32(36)48)41-34(50)29(42-33(49)28(40-25(3)46)15-7-10-20-38-24(2)45)16-8-11-21-39-31(47)18-12-22-51-35-43-26-13-4-5-17-30(26)52-35/h4-5,13,17,27-29H,6-12,14-16,18-22H2,1-3H3,(H2,36,48)(H,37,44)(H,38,45)(H,39,47)(H,40,46)(H,41,50)(H,42,49)/t27-,28-,29-/m0/s1 |
| InChIKey | ATTKYDRYLKRMQD-AWCRTANDSA-N |
| XLogP | 2.03 |
| TPSA | 230.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.00 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|