C13H29N3O4 — CID 158444178
3-(15N)azanylpropanoic acid;carbane;N-[5-((113C)methylamino)-6-oxohexyl]acetamide (PubChem CID 158444178) has the molecular formula C13H29N3O4 and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-(15N)azanylpropanoic acid;carbane;N-[5-((113C)methylamino)-6-oxohexyl]acetamide.
| Compound Name | 3-(15N)azanylpropanoic acid;carbane;N-[5-((113C)methylamino)-6-oxohexyl]acetamide |
|---|---|
| PubChem CID | 158444178 |
| Molecular Formula | C13H29N3O4 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | 3-(15N)azanylpropanoic acid;carbane;N-[5-((113C)methylamino)-6-oxohexyl]acetamide |
| SMILES | [13CH3]NC(C=O)CCCCNC([13CH3])=O.[13CH4].[15NH2]CCC(=O)O |
| InChI | InChI=1S/C9H18N2O2.C3H7NO2.CH4/c1-8(13)11-6-4-3-5-9(7-12)10-2;4-2-1-3(5)6;/h7,9-10H,3-6H2,1-2H3,(H,11,13);1-2,4H2,(H,5,6);1H4/i1+1,2+1;4+1;1+1 |
| InChIKey | HDELBIVIDCFSNV-ZSTJSQNSSA-N |
| XLogP | 0.14 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|