C12H25N3O5 — CID 172563632
1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea (PubChem CID 172563632) has the molecular formula C12H25N3O5 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea.
| Compound Name | 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea |
|---|---|
| PubChem CID | 172563632 |
| Molecular Formula | C12H25N3O5 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea |
| SMILES | CNC(C=O)CCCCNC(=O)NC(CO)(CO)CO |
| InChI | InChI=1S/C12H25N3O5/c1-13-10(6-16)4-2-3-5-14-11(20)15-12(7-17,8-18)9-19/h6,10,13,17-19H,2-5,7-9H2,1H3,(H2,14,15,20) |
| InChIKey | YKMHQFAZNPPOSG-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|