C15H31N3O7 — CID 172563560
1-[1-(1,3-dihydroxypropan-2-yloxy)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea (PubChem CID 172563560) has the molecular formula C15H31N3O7 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[1-(1,3-dihydroxypropan-2-yloxy)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea.
| Compound Name | 1-[1-(1,3-dihydroxypropan-2-yloxy)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea |
|---|---|
| PubChem CID | 172563560 |
| Molecular Formula | C15H31N3O7 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-[1-(1,3-dihydroxypropan-2-yloxy)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-3-[5-(methylamino)-6-oxohexyl]urea |
| SMILES | CNC(C=O)CCCCNC(=O)NC(CO)(CO)COC(CO)CO |
| InChI | InChI=1S/C15H31N3O7/c1-16-12(6-19)4-2-3-5-17-14(24)18-15(9-22,10-23)11-25-13(7-20)8-21/h6,12-13,16,20-23H,2-5,7-11H2,1H3,(H2,17,18,24) |
| InChIKey | RVFYYNLKXFMWAB-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 160.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|