C12H26N2O5 — CID 59197386
1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-[2-(2-methylpropylperoxy)ethyl]urea (PubChem CID 59197386) has the molecular formula C12H26N2O5 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-[2-(2-methylpropylperoxy)ethyl]urea.
| Compound Name | 1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-[2-(2-methylpropylperoxy)ethyl]urea |
|---|---|
| PubChem CID | 59197386 |
| Molecular Formula | C12H26N2O5 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-[2-(2-methylpropylperoxy)ethyl]urea |
| SMILES | CCC(CO)(CO)NC(=O)NCCOOCC(C)C |
| InChI | InChI=1S/C12H26N2O5/c1-4-12(8-15,9-16)14-11(17)13-5-6-18-19-7-10(2)3/h10,15-16H,4-9H2,1-3H3,(H2,13,14,17) |
| InChIKey | FFJLJYQVNGLVPZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|