C10H22N2O5 — CID 59197392
1-(1,3-dihydroxypropan-2-yl)-3-[2-(2-methylpropylperoxy)ethyl]urea (PubChem CID 59197392) has the molecular formula C10H22N2O5 and a molecular weight of 250.29 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropan-2-yl)-3-[2-(2-methylpropylperoxy)ethyl]urea.
| Compound Name | 1-(1,3-dihydroxypropan-2-yl)-3-[2-(2-methylpropylperoxy)ethyl]urea |
|---|---|
| PubChem CID | 59197392 |
| Molecular Formula | C10H22N2O5 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-(1,3-dihydroxypropan-2-yl)-3-[2-(2-methylpropylperoxy)ethyl]urea |
| SMILES | CC(C)COOCCNC(=O)NC(CO)CO |
| InChI | InChI=1S/C10H22N2O5/c1-8(2)7-17-16-4-3-11-10(15)12-9(5-13)6-14/h8-9,13-14H,3-7H2,1-2H3,(H2,11,12,15) |
| InChIKey | KJSSZOWSPZAACR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|