C16H36N3O6P — CID 156747557
ethane;6-(3-formamidopropanoylamino)hexyl methyl hydrogen phosphite;N-methylacetamide (PubChem CID 156747557) has the molecular formula C16H36N3O6P and a molecular weight of 397.45 g/mol. Its IUPAC name is ethane;6-(3-formamidopropanoylamino)hexyl methyl hydrogen phosphite;N-methylacetamide.
| Compound Name | ethane;6-(3-formamidopropanoylamino)hexyl methyl hydrogen phosphite;N-methylacetamide |
|---|---|
| PubChem CID | 156747557 |
| Molecular Formula | C16H36N3O6P |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | ethane;6-(3-formamidopropanoylamino)hexyl methyl hydrogen phosphite;N-methylacetamide |
| SMILES | CC.CNC(C)=O.COP(O)OCCCCCCNC(=O)CCNC=O |
| InChI | InChI=1S/C11H23N2O5P.C3H7NO.C2H6/c1-17-19(16)18-9-5-3-2-4-7-13-11(15)6-8-12-10-14;1-3(5)4-2;1-2/h10,16H,2-9H2,1H3,(H,12,14)(H,13,15);1-2H3,(H,4,5);1-2H3 |
| InChIKey | ZRLGPTVQSPUUSY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|