C8H18BNO3S — CID 165120853
CID 165120853 (PubChem CID 165120853) has the molecular formula C8H18BNO3S and a molecular weight of 219.11 g/mol.
| Compound Name | CID 165120853 |
|---|---|
| PubChem CID | 165120853 |
| Molecular Formula | C8H18BNO3S |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | — |
| SMILES | CC.[B]CC(=O)NC(COC)COS |
| InChI | InChI=1S/C6H12BNO3S.C2H6/c1-10-3-5(4-11-12)8-6(9)2-7;1-2/h5,12H,2-4H2,1H3,(H,8,9);1-2H3 |
| InChIKey | HLJVXGVPEHFADB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|