C7H18N2O5S2 — CID 106181408
N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylethanesulfonamide (PubChem CID 106181408) has the molecular formula C7H18N2O5S2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylethanesulfonamide.
| Compound Name | N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 106181408 |
| Molecular Formula | C7H18N2O5S2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylethanesulfonamide |
| SMILES | COCC(CN)NS(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C7H18N2O5S2/c1-14-6-7(5-8)9-16(12,13)4-3-15(2,10)11/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | OEEZKHTXGSQETG-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |