C10H21IO3Si — CID 154140046
2-[tert-butyl(dimethyl)silyl]oxy-4-iodobutanoic acid (PubChem CID 154140046) has the molecular formula C10H21IO3Si and a molecular weight of 344.27 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-4-iodobutanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-iodobutanoic acid |
|---|---|
| PubChem CID | 154140046 |
| Molecular Formula | C10H21IO3Si |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-iodobutanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCI)C(=O)O |
| InChI | InChI=1S/C10H21IO3Si/c1-10(2,3)15(4,5)14-8(6-7-11)9(12)13/h8H,6-7H2,1-5H3,(H,12,13) |
| InChIKey | CEBAWSYYPPSBKX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|