C21H29IOSi — CID 87181942
tert-butyl-[(E)-4-iodo-3-(naphthalen-2-ylmethyl)but-3-en-2-yl]oxy-dimethylsilane (PubChem CID 87181942) has the molecular formula C21H29IOSi and a molecular weight of 452.45 g/mol. Its IUPAC name is tert-butyl-[(E)-4-iodo-3-(naphthalen-2-ylmethyl)but-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-iodo-3-(naphthalen-2-ylmethyl)but-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 87181942 |
| Molecular Formula | C21H29IOSi |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | tert-butyl-[(E)-4-iodo-3-(naphthalen-2-ylmethyl)but-3-en-2-yl]oxy-dimethylsilane |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)/C(=C/I)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H29IOSi/c1-16(23-24(5,6)21(2,3)4)20(15-22)14-17-11-12-18-9-7-8-10-19(18)13-17/h7-13,15-16H,14H2,1-6H3/b20-15+ |
| InChIKey | OLBIDJCJIDYTGH-HMMYKYKNSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|