C32H48N2O6 — CID 23583710
[(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(3-oxo-4H-1,4-benzoxazin-6-yl)heptadeca-3,11,16-trien-6-yl] carbamate (PubChem CID 23583710) has the molecular formula C32H48N2O6 and a molecular weight of 556.74 g/mol. Its IUPAC name is [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(3-oxo-4H-1,4-benzoxazin-6-yl)heptadeca-3,11,16-trien-6-yl] carbamate.
| Compound Name | [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(3-oxo-4H-1,4-benzoxazin-6-yl)heptadeca-3,11,16-trien-6-yl] carbamate |
|---|---|
| PubChem CID | 23583710 |
| Molecular Formula | C32H48N2O6 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z)-8,14-dihydroxy-5,7,9,11,13,15-hexamethyl-17-(3-oxo-4H-1,4-benzoxazin-6-yl)heptadeca-3,11,16-trien-6-yl] carbamate |
| SMILES | CC/C=C\[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O)[C@@H](C)/C=C\c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C32H48N2O6/c1-8-9-10-21(4)31(40-32(33)38)24(7)30(37)23(6)16-19(2)15-22(5)29(36)20(3)11-12-25-13-14-27-26(17-25)34-28(35)18-39-27/h9-15,17,20-24,29-31,36-37H,8,16,18H2,1-7H3,(H2,33,38)(H,34,35)/b10-9-,12-11-,19-15-/t20-,21-,22-,23-,24-,29-,30+,31-/m0/s1 |
| InChIKey | UIPZMZVGHKLUND-BQDVUEQJSA-N |
| XLogP | 5.70 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|