C36H60N2O7 — CID 53379512
[(3S,4Z,6S,7S,8S,9Z,12S,13R,14S,15S,16S)-15-carbamoyloxy-3,7,13-trihydroxy-6,8,10,12,14,16-hexamethylicosa-4,9-dienyl] 3-(dimethylamino)benzoate (PubChem CID 53379512) has the molecular formula C36H60N2O7 and a molecular weight of 632.88 g/mol. Its IUPAC name is [(3S,4Z,6S,7S,8S,9Z,12S,13R,14S,15S,16S)-15-carbamoyloxy-3,7,13-trihydroxy-6,8,10,12,14,16-hexamethylicosa-4,9-dienyl] 3-(dimethylamino)benzoate.
| Compound Name | [(3S,4Z,6S,7S,8S,9Z,12S,13R,14S,15S,16S)-15-carbamoyloxy-3,7,13-trihydroxy-6,8,10,12,14,16-hexamethylicosa-4,9-dienyl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 53379512 |
| Molecular Formula | C36H60N2O7 |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.44 |
| IUPAC Name | [(3S,4Z,6S,7S,8S,9Z,12S,13R,14S,15S,16S)-15-carbamoyloxy-3,7,13-trihydroxy-6,8,10,12,14,16-hexamethylicosa-4,9-dienyl] 3-(dimethylamino)benzoate |
| SMILES | CCCC[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O)[C@@H](C)/C=C\[C@@H](O)CCOC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C36H60N2O7/c1-10-11-13-25(4)34(45-36(37)43)28(7)33(41)27(6)21-23(2)20-26(5)32(40)24(3)16-17-31(39)18-19-44-35(42)29-14-12-15-30(22-29)38(8)9/h12,14-17,20,22,24-28,31-34,39-41H,10-11,13,18-19,21H2,1-9H3,(H2,37,43)/b17-16-,23-20-/t24-,25-,26-,27-,28-,31+,32-,33+,34-/m0/s1 |
| InChIKey | DJGQJZJJYVQXAJ-YBVGALNDSA-N |
| XLogP | 6.11 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|