C32H56N2O10 — CID 173186351
13-[(6-carbamoyloxy-4-hydroxy-3,5,7-trimethyl-2-oxoundeca-8,10-dienyl)amino]-3,5,7,11-tetrahydroxy-2,4,10,12-tetramethyltridec-8-enoic acid (PubChem CID 173186351) has the molecular formula C32H56N2O10 and a molecular weight of 628.80 g/mol. Its IUPAC name is 13-[(6-carbamoyloxy-4-hydroxy-3,5,7-trimethyl-2-oxoundeca-8,10-dienyl)amino]-3,5,7,11-tetrahydroxy-2,4,10,12-tetramethyltridec-8-enoic acid.
| Compound Name | 13-[(6-carbamoyloxy-4-hydroxy-3,5,7-trimethyl-2-oxoundeca-8,10-dienyl)amino]-3,5,7,11-tetrahydroxy-2,4,10,12-tetramethyltridec-8-enoic acid |
|---|---|
| PubChem CID | 173186351 |
| Molecular Formula | C32H56N2O10 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.39 |
| IUPAC Name | 13-[(6-carbamoyloxy-4-hydroxy-3,5,7-trimethyl-2-oxoundeca-8,10-dienyl)amino]-3,5,7,11-tetrahydroxy-2,4,10,12-tetramethyltridec-8-enoic acid |
| SMILES | C=CC=CC(C)C(OC(N)=O)C(C)C(O)C(C)C(=O)CNCC(C)C(O)C(C)C=CC(O)CC(O)C(C)C(O)C(C)C(=O)O |
| InChI | InChI=1S/C32H56N2O10/c1-9-10-11-18(3)30(44-32(33)43)22(7)28(39)21(6)26(37)16-34-15-19(4)27(38)17(2)12-13-24(35)14-25(36)20(5)29(40)23(8)31(41)42/h9-13,17-25,27-30,34-36,38-40H,1,14-16H2,2-8H3,(H2,33,43)(H,41,42) |
| InChIKey | SOINTMWXMNPQHA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 219.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|