C30H49NO7 — CID 11678218
[(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-(5-oxooxolan-2-yl)nonadeca-1,3,11,16-tetraen-6-yl] carbamate (PubChem CID 11678218) has the molecular formula C30H49NO7 and a molecular weight of 535.72 g/mol. Its IUPAC name is [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-(5-oxooxolan-2-yl)nonadeca-1,3,11,16-tetraen-6-yl] carbamate.
| Compound Name | [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-(5-oxooxolan-2-yl)nonadeca-1,3,11,16-tetraen-6-yl] carbamate |
|---|---|
| PubChem CID | 11678218 |
| Molecular Formula | C30H49NO7 |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.35 |
| IUPAC Name | [(3Z,5S,6S,7S,8R,9S,11Z,13S,14S,15S,16Z,18S)-8,14,18-trihydroxy-5,7,9,11,13,15-hexamethyl-19-(5-oxooxolan-2-yl)nonadeca-1,3,11,16-tetraen-6-yl] carbamate |
| SMILES | C=C/C=C\[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O)[C@@H](C)/C=C\[C@@H](O)CC1CCC(=O)O1 |
| InChI | InChI=1S/C30H49NO7/c1-8-9-10-20(4)29(38-30(31)36)23(7)28(35)22(6)16-18(2)15-21(5)27(34)19(3)11-12-24(32)17-25-13-14-26(33)37-25/h8-12,15,19-25,27-29,32,34-35H,1,13-14,16-17H2,2-7H3,(H2,31,36)/b10-9-,12-11-,18-15-/t19-,20-,21-,22-,23-,24+,25?,27-,28+,29-/m0/s1 |
| InChIKey | AJHGUBZUXQXQHA-WHTYSAIASA-N |
| XLogP | 4.44 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|