C16H20O3 — CID 44519885
2-[4-(4-methoxyphenyl)buta-2,3-dienoxy]oxane (PubChem CID 44519885) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)buta-2,3-dienoxy]oxane.
| Compound Name | 2-[4-(4-methoxyphenyl)buta-2,3-dienoxy]oxane |
|---|---|
| PubChem CID | 44519885 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)buta-2,3-dienoxy]oxane |
| SMILES | COc1ccc(C=C=CCOC2CCCCO2)cc1 |
| InChI | InChI=1S/C16H20O3/c1-17-15-10-8-14(9-11-15)6-2-4-12-18-16-7-3-5-13-19-16/h4,6,8-11,16H,3,5,7,12-13H2,1H3 |
| InChIKey | FFYJHIBPEMFNNV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |