C17H22ClNO4 — CID 89229508
5-(chloromethyl)-2-(4-methoxyphenyl)-4-(oxan-2-yloxymethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 89229508) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(4-methoxyphenyl)-4-(oxan-2-yloxymethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-(chloromethyl)-2-(4-methoxyphenyl)-4-(oxan-2-yloxymethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 89229508 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-(chloromethyl)-2-(4-methoxyphenyl)-4-(oxan-2-yloxymethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | COc1ccc(C2=NC(COC3CCCCO3)C(CCl)O2)cc1 |
| InChI | InChI=1S/C17H22ClNO4/c1-20-13-7-5-12(6-8-13)17-19-14(15(10-18)23-17)11-22-16-4-2-3-9-21-16/h5-8,14-16H,2-4,9-11H2,1H3 |
| InChIKey | DSMSWHWXWNACOD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|