C10H17ClO3 — CID 11964355
2-[2-[(2R,3S)-3-(chloromethyl)oxiran-2-yl]ethoxy]oxane (PubChem CID 11964355) has the molecular formula C10H17ClO3 and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-[2-[(2R,3S)-3-(chloromethyl)oxiran-2-yl]ethoxy]oxane.
| Compound Name | 2-[2-[(2R,3S)-3-(chloromethyl)oxiran-2-yl]ethoxy]oxane |
|---|---|
| PubChem CID | 11964355 |
| Molecular Formula | C10H17ClO3 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-[2-[(2R,3S)-3-(chloromethyl)oxiran-2-yl]ethoxy]oxane |
| SMILES | ClC[C@H]1O[C@@H]1CCOC1CCCCO1 |
| InChI | InChI=1S/C10H17ClO3/c11-7-9-8(14-9)4-6-13-10-3-1-2-5-12-10/h8-10H,1-7H2/t8-,9-,10?/m1/s1 |
| InChIKey | MQKPXTCVXSTLBI-MGRQHWMJSA-N |
| XLogP | 1.93 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|