C17H20BrF2N3O3 — CID 59138041
5-[bromo(difluoro)methyl]-1-[(4-methoxyphenyl)methyl]-4-(oxan-2-yloxymethyl)triazole (PubChem CID 59138041) has the molecular formula C17H20BrF2N3O3 and a molecular weight of 432.27 g/mol. Its IUPAC name is 5-[bromo(difluoro)methyl]-1-[(4-methoxyphenyl)methyl]-4-(oxan-2-yloxymethyl)triazole.
| Compound Name | 5-[bromo(difluoro)methyl]-1-[(4-methoxyphenyl)methyl]-4-(oxan-2-yloxymethyl)triazole |
|---|---|
| PubChem CID | 59138041 |
| Molecular Formula | C17H20BrF2N3O3 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 5-[bromo(difluoro)methyl]-1-[(4-methoxyphenyl)methyl]-4-(oxan-2-yloxymethyl)triazole |
| SMILES | COc1ccc(Cn2nnc(COC3CCCCO3)c2C(F)(F)Br)cc1 |
| InChI | InChI=1S/C17H20BrF2N3O3/c1-24-13-7-5-12(6-8-13)10-23-16(17(18,19)20)14(21-22-23)11-26-15-4-2-3-9-25-15/h5-8,15H,2-4,9-11H2,1H3 |
| InChIKey | WLQBIEJOTISZQY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|