C24H26O5 — CID 135021591
2-[4-[3-(1,4-dimethoxynaphthalen-2-yl)propa-1,2-dienoxy]buta-2,3-dienoxy]oxane (PubChem CID 135021591) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[4-[3-(1,4-dimethoxynaphthalen-2-yl)propa-1,2-dienoxy]buta-2,3-dienoxy]oxane.
| Compound Name | 2-[4-[3-(1,4-dimethoxynaphthalen-2-yl)propa-1,2-dienoxy]buta-2,3-dienoxy]oxane |
|---|---|
| PubChem CID | 135021591 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[4-[3-(1,4-dimethoxynaphthalen-2-yl)propa-1,2-dienoxy]buta-2,3-dienoxy]oxane |
| SMILES | COc1cc(C=C=COC=C=CCOC2CCCCO2)c(OC)c2ccccc12 |
| InChI | InChI=1S/C24H26O5/c1-25-22-18-19(24(26-2)21-12-4-3-11-20(21)22)10-9-15-27-14-7-8-17-29-23-13-5-6-16-28-23/h3-4,8,10-12,14-15,18,23H,5-6,13,16-17H2,1-2H3 |
| InChIKey | QYMLPNQJWOCGJX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|