C16H26O4 — CID 135037180
2-[(2E,4Z)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpenta-2,4-dienoxy]oxane (PubChem CID 135037180) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[(2E,4Z)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpenta-2,4-dienoxy]oxane.
| Compound Name | 2-[(2E,4Z)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpenta-2,4-dienoxy]oxane |
|---|---|
| PubChem CID | 135037180 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[(2E,4Z)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpenta-2,4-dienoxy]oxane |
| SMILES | C/C(=C\C=C/[C@H]1COC(C)(C)O1)COC1CCCCO1 |
| InChI | InChI=1S/C16H26O4/c1-13(11-18-15-9-4-5-10-17-15)7-6-8-14-12-19-16(2,3)20-14/h6-8,14-15H,4-5,9-12H2,1-3H3/b8-6-,13-7+/t14-,15?/m0/s1 |
| InChIKey | YVVRSRJYJNQEOZ-QLSVEELGSA-N |
| XLogP | 3.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|