C11H18O3 — CID 144852096
(2E,4Z)-1-(oxan-2-yloxy)hexa-2,4-dien-2-ol (PubChem CID 144852096) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (2E,4Z)-1-(oxan-2-yloxy)hexa-2,4-dien-2-ol.
| Compound Name | (2E,4Z)-1-(oxan-2-yloxy)hexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 144852096 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (2E,4Z)-1-(oxan-2-yloxy)hexa-2,4-dien-2-ol |
| SMILES | C/C=C\C=C(\O)COC1CCCCO1 |
| InChI | InChI=1S/C11H18O3/c1-2-3-6-10(12)9-14-11-7-4-5-8-13-11/h2-3,6,11-12H,4-5,7-9H2,1H3/b3-2-,10-6+ |
| InChIKey | XJGQSOSFUBGPLG-BWFNYKPYSA-N |
| XLogP | 2.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|