C18H32O5 — CID 10664061
(E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-en-1-ol (PubChem CID 10664061) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-en-1-ol.
| Compound Name | (E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-en-1-ol |
|---|---|
| PubChem CID | 10664061 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-en-1-ol |
| SMILES | CC1(C)OC[C@H](/C=C/C(CCCCCO)OC2CCCCO2)O1 |
| InChI | InChI=1S/C18H32O5/c1-18(2)21-14-16(23-18)11-10-15(8-4-3-6-12-19)22-17-9-5-7-13-20-17/h10-11,15-17,19H,3-9,12-14H2,1-2H3/b11-10+/t15?,16-,17?/m0/s1 |
| InChIKey | JLVFLZSALVPFDU-JZIMIMQNSA-N |
| XLogP | 3.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|