C23H31ClO5 — CID 76512809
5-chloro-3-[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde (PubChem CID 76512809) has the molecular formula C23H31ClO5 and a molecular weight of 422.95 g/mol. Its IUPAC name is 5-chloro-3-[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde.
| Compound Name | 5-chloro-3-[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 76512809 |
| Molecular Formula | C23H31ClO5 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 5-chloro-3-[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde |
| SMILES | CC(=CCc1c(O)c(Cl)c(C)c(C=O)c1O)CCC=C(C)COC1CCCCO1 |
| InChI | InChI=1S/C23H31ClO5/c1-15(7-6-8-16(2)14-29-20-9-4-5-12-28-20)10-11-18-22(26)19(13-25)17(3)21(24)23(18)27/h8,10,13,20,26-27H,4-7,9,11-12,14H2,1-3H3 |
| InChIKey | ZTQKRSHUZXAYQT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|