C21H29ClO5 — CID 86701339
[(E)-7-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-5-methylhept-5-enyl] 2,2-dimethylpropanoate (PubChem CID 86701339) has the molecular formula C21H29ClO5 and a molecular weight of 396.91 g/mol. Its IUPAC name is [(E)-7-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-5-methylhept-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-7-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-5-methylhept-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 86701339 |
| Molecular Formula | C21H29ClO5 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [(E)-7-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-5-methylhept-5-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\Cc1c(O)c(Cl)c(C)c(C=O)c1O)CCCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H29ClO5/c1-13(8-6-7-11-27-20(26)21(3,4)5)9-10-15-18(24)16(12-23)14(2)17(22)19(15)25/h9,12,24-25H,6-8,10-11H2,1-5H3/b13-9+ |
| InChIKey | PANUBHYBHFGOLS-UKTHLTGXSA-N |
| XLogP | 5.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|