C21H27ClO5 — CID 123989170
[9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-3,7-dimethylnona-3,7-dien-2-yl] acetate (PubChem CID 123989170) has the molecular formula C21H27ClO5 and a molecular weight of 394.90 g/mol. Its IUPAC name is [9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-3,7-dimethylnona-3,7-dien-2-yl] acetate.
| Compound Name | [9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-3,7-dimethylnona-3,7-dien-2-yl] acetate |
|---|---|
| PubChem CID | 123989170 |
| Molecular Formula | C21H27ClO5 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-3,7-dimethylnona-3,7-dien-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(C)=CCCC(C)=CCc1c(O)c(Cl)c(C)c(C=O)c1O |
| InChI | InChI=1S/C21H27ClO5/c1-12(7-6-8-13(2)15(4)27-16(5)24)9-10-17-20(25)18(11-23)14(3)19(22)21(17)26/h8-9,11,15,25-26H,6-7,10H2,1-5H3 |
| InChIKey | YBGJUDVVSGWLOR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|