C23H31ClO4 — CID 135191935
5-chloro-2,4-dihydroxy-3-[(2E,6E,8E)-8-methoxy-3,7,9-trimethylundeca-2,6,8-trienyl]-6-methylbenzaldehyde (PubChem CID 135191935) has the molecular formula C23H31ClO4 and a molecular weight of 406.95 g/mol. Its IUPAC name is 5-chloro-2,4-dihydroxy-3-[(2E,6E,8E)-8-methoxy-3,7,9-trimethylundeca-2,6,8-trienyl]-6-methylbenzaldehyde.
| Compound Name | 5-chloro-2,4-dihydroxy-3-[(2E,6E,8E)-8-methoxy-3,7,9-trimethylundeca-2,6,8-trienyl]-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 135191935 |
| Molecular Formula | C23H31ClO4 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 5-chloro-2,4-dihydroxy-3-[(2E,6E,8E)-8-methoxy-3,7,9-trimethylundeca-2,6,8-trienyl]-6-methylbenzaldehyde |
| SMILES | CC/C(C)=C(OC)\C(C)=C\CC/C(C)=C/Cc1c(O)c(Cl)c(C)c(C=O)c1O |
| InChI | InChI=1S/C23H31ClO4/c1-7-15(3)23(28-6)16(4)10-8-9-14(2)11-12-18-21(26)19(13-25)17(5)20(24)22(18)27/h10-11,13,26-27H,7-9,12H2,1-6H3/b14-11+,16-10+,23-15+ |
| InChIKey | ZHTJRUUOGYCTDZ-UBGADSMGSA-N |
| XLogP | 6.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|