C21H29ClO5 — CID 141335763
(E)-10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-2,2,8-trimethyldec-8-enoic acid (PubChem CID 141335763) has the molecular formula C21H29ClO5 and a molecular weight of 396.91 g/mol. Its IUPAC name is (E)-10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-2,2,8-trimethyldec-8-enoic acid.
| Compound Name | (E)-10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-2,2,8-trimethyldec-8-enoic acid |
|---|---|
| PubChem CID | 141335763 |
| Molecular Formula | C21H29ClO5 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (E)-10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-2,2,8-trimethyldec-8-enoic acid |
| SMILES | C/C(=C\Cc1c(O)c(Cl)c(C)c(C=O)c1O)CCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C21H29ClO5/c1-13(8-6-5-7-11-21(3,4)20(26)27)9-10-15-18(24)16(12-23)14(2)17(22)19(15)25/h9,12,24-25H,5-8,10-11H2,1-4H3,(H,26,27)/b13-9+ |
| InChIKey | AQMAGEHQOLZGMV-UKTHLTGXSA-N |
| XLogP | 5.42 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|