C22H33ClO7 — CID 88557331
(3-hydroxy-2-methoxypropyl) 10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)decanoate (PubChem CID 88557331) has the molecular formula C22H33ClO7 and a molecular weight of 444.95 g/mol. Its IUPAC name is (3-hydroxy-2-methoxypropyl) 10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)decanoate.
| Compound Name | (3-hydroxy-2-methoxypropyl) 10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)decanoate |
|---|---|
| PubChem CID | 88557331 |
| Molecular Formula | C22H33ClO7 |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (3-hydroxy-2-methoxypropyl) 10-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)decanoate |
| SMILES | COC(CO)COC(=O)CCCCCCCCCc1c(O)c(Cl)c(C)c(C=O)c1O |
| InChI | InChI=1S/C22H33ClO7/c1-15-18(13-25)21(27)17(22(28)20(15)23)10-8-6-4-3-5-7-9-11-19(26)30-14-16(12-24)29-2/h13,16,24,27-28H,3-12,14H2,1-2H3 |
| InChIKey | VOIDKQTWKAOFQD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|