C21H31ClO5 — CID 87428401
9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)nonyl 2-methylpropanoate (PubChem CID 87428401) has the molecular formula C21H31ClO5 and a molecular weight of 398.93 g/mol. Its IUPAC name is 9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)nonyl 2-methylpropanoate.
| Compound Name | 9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)nonyl 2-methylpropanoate |
|---|---|
| PubChem CID | 87428401 |
| Molecular Formula | C21H31ClO5 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)nonyl 2-methylpropanoate |
| SMILES | Cc1c(Cl)c(O)c(CCCCCCCCCOC(=O)C(C)C)c(O)c1C=O |
| InChI | InChI=1S/C21H31ClO5/c1-14(2)21(26)27-12-10-8-6-4-5-7-9-11-16-19(24)17(13-23)15(3)18(22)20(16)25/h13-14,24-25H,4-12H2,1-3H3 |
| InChIKey | NYBCDYYNZLNPOI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|