C36H35N2O4P — CID 11975937
benzyl N-[[methoxy-[(tritylamino)methyl]phosphoryl]-phenylmethyl]carbamate (PubChem CID 11975937) has the molecular formula C36H35N2O4P and a molecular weight of 590.66 g/mol. Its IUPAC name is benzyl N-[[methoxy-[(tritylamino)methyl]phosphoryl]-phenylmethyl]carbamate.
| Compound Name | benzyl N-[[methoxy-[(tritylamino)methyl]phosphoryl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 11975937 |
| Molecular Formula | C36H35N2O4P |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | benzyl N-[[methoxy-[(tritylamino)methyl]phosphoryl]-phenylmethyl]carbamate |
| SMILES | COP(=O)(CNC(c1ccccc1)(c1ccccc1)c1ccccc1)C(NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H35N2O4P/c1-41-43(40,34(30-19-9-3-10-20-30)38-35(39)42-27-29-17-7-2-8-18-29)28-37-36(31-21-11-4-12-22-31,32-23-13-5-14-24-32)33-25-15-6-16-26-33/h2-26,34,37H,27-28H2,1H3,(H,38,39) |
| InChIKey | SWPAZKGPYYMATF-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|