C26H25NO4S — CID 151229341
methyl (2S,3R)-3-hydroxy-2-[[4-[2-[2-(4-methylphenyl)phenyl]ethynyl]phenyl]sulfinylamino]butanoate (PubChem CID 151229341) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[[4-[2-[2-(4-methylphenyl)phenyl]ethynyl]phenyl]sulfinylamino]butanoate.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-[[4-[2-[2-(4-methylphenyl)phenyl]ethynyl]phenyl]sulfinylamino]butanoate |
|---|---|
| PubChem CID | 151229341 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-[[4-[2-[2-(4-methylphenyl)phenyl]ethynyl]phenyl]sulfinylamino]butanoate |
| SMILES | COC(=O)[C@@H](NS(=O)c1ccc(C#Cc2ccccc2-c2ccc(C)cc2)cc1)[C@@H](C)O |
| InChI | InChI=1S/C26H25NO4S/c1-18-8-13-22(14-9-18)24-7-5-4-6-21(24)15-10-20-11-16-23(17-12-20)32(30)27-25(19(2)28)26(29)31-3/h4-9,11-14,16-17,19,25,27-28H,1-3H3/t19-,25+,32?/m1/s1 |
| InChIKey | NNYIOJDJJAODTK-DRGYUIEYSA-N |
| XLogP | 3.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|