C19H18O3 — CID 134846051
methyl (2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoate (PubChem CID 134846051) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoate.
| Compound Name | methyl (2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoate |
|---|---|
| PubChem CID | 134846051 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl (2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoate |
| SMILES | COC(=O)[C@H](c1ccccc1)[C@H](O)C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C19H18O3/c1-14-8-10-15(11-9-14)12-13-17(20)18(19(21)22-2)16-6-4-3-5-7-16/h3-11,17-18,20H,1-2H3/t17-,18-/m1/s1 |
| InChIKey | MYQPMEQMDWBTNJ-QZTJIDSGSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|