C18H16O3 — CID 134845759
(2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoic acid (PubChem CID 134845759) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoic acid.
| Compound Name | (2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoic acid |
|---|---|
| PubChem CID | 134845759 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2R,3S)-3-hydroxy-5-(4-methylphenyl)-2-phenylpent-4-ynoic acid |
| SMILES | Cc1ccc(C#C[C@@H](O)[C@H](C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16O3/c1-13-7-9-14(10-8-13)11-12-16(19)17(18(20)21)15-5-3-2-4-6-15/h2-10,16-17,19H,1H3,(H,20,21)/t16-,17-/m1/s1 |
| InChIKey | BCPSWSBERBFHDB-IAGOWNOFSA-N |
| XLogP | 2.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|