C15H24N2O3S — CID 102085256
(2R,3S)-N-methoxy-N,2-dimethyl-3-[(4-methylphenyl)sulfinylamino]pentanamide (PubChem CID 102085256) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is (2R,3S)-N-methoxy-N,2-dimethyl-3-[(4-methylphenyl)sulfinylamino]pentanamide.
| Compound Name | (2R,3S)-N-methoxy-N,2-dimethyl-3-[(4-methylphenyl)sulfinylamino]pentanamide |
|---|---|
| PubChem CID | 102085256 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2R,3S)-N-methoxy-N,2-dimethyl-3-[(4-methylphenyl)sulfinylamino]pentanamide |
| SMILES | CC[C@H](NS(=O)c1ccc(C)cc1)[C@@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C15H24N2O3S/c1-6-14(12(3)15(18)17(4)20-5)16-21(19)13-9-7-11(2)8-10-13/h7-10,12,14,16H,6H2,1-5H3/t12-,14+,21?/m1/s1 |
| InChIKey | JPEXIQZQURFFHS-IOVQPCCLSA-N |
| XLogP | 2.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|