C14H26N2OS — CID 142604034
N-[1-(dimethylamino)propan-2-yl]-4-methylbenzenesulfinamide;ethane (PubChem CID 142604034) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-4-methylbenzenesulfinamide;ethane.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-4-methylbenzenesulfinamide;ethane |
|---|---|
| PubChem CID | 142604034 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-4-methylbenzenesulfinamide;ethane |
| SMILES | CC.Cc1ccc(S(=O)NC(C)CN(C)C)cc1 |
| InChI | InChI=1S/C12H20N2OS.C2H6/c1-10-5-7-12(8-6-10)16(15)13-11(2)9-14(3)4;1-2/h5-8,11,13H,9H2,1-4H3;1-2H3 |
| InChIKey | SVGHXMAISRKHJV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |