C14H14F6N2OS — CID 87453192
4-methyl-N-[(1S)-4,4,4-trifluoro-1-isocyano-2-(2,2,2-trifluoroethyl)butyl]benzenesulfinamide (PubChem CID 87453192) has the molecular formula C14H14F6N2OS and a molecular weight of 372.33 g/mol. Its IUPAC name is 4-methyl-N-[(1S)-4,4,4-trifluoro-1-isocyano-2-(2,2,2-trifluoroethyl)butyl]benzenesulfinamide.
| Compound Name | 4-methyl-N-[(1S)-4,4,4-trifluoro-1-isocyano-2-(2,2,2-trifluoroethyl)butyl]benzenesulfinamide |
|---|---|
| PubChem CID | 87453192 |
| Molecular Formula | C14H14F6N2OS |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 4-methyl-N-[(1S)-4,4,4-trifluoro-1-isocyano-2-(2,2,2-trifluoroethyl)butyl]benzenesulfinamide |
| SMILES | [C-]#[N+][C@@H](NS(=O)c1ccc(C)cc1)C(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C14H14F6N2OS/c1-9-3-5-11(6-4-9)24(23)22-12(21-2)10(7-13(15,16)17)8-14(18,19)20/h3-6,10,12,22H,7-8H2,1H3/t12-,24?/m0/s1 |
| InChIKey | YDDGIDXTJCQLLT-JMSDCMLSSA-N |
| XLogP | 4.37 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|